C24H18BrClN4O4S — CID 23804087
N-(6-bromo-1,3-benzothiazol-2-yl)-4-(2-chloro-5-nitrophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 23804087) has the molecular formula C24H18BrClN4O4S and a molecular weight of 573.86 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-4-(2-chloro-5-nitrophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-(2-chloro-5-nitrophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 23804087 |
| Molecular Formula | C24H18BrClN4O4S |
| Molecular Weight | 573.86 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-(2-chloro-5-nitrophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2nc3ccc(Br)cc3s2)C(c2cc([N+](=O)[O-])ccc2Cl)C2=C(CCCC2=O)N1 |
| InChI | InChI=1S/C24H18BrClN4O4S/c1-11-20(23(32)29-24-28-16-8-5-12(25)9-19(16)35-24)21(22-17(27-11)3-2-4-18(22)31)14-10-13(30(33)34)6-7-15(14)26/h5-10,21,27H,2-4H2,1H3,(H,28,29,32) |
| InChIKey | IYZWFMTXTNNNQP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.86 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|