C29H34N2O6 — CID 996842
(4S)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 996842) has the molecular formula C29H34N2O6 and a molecular weight of 506.60 g/mol. Its IUPAC name is (4S)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (4S)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 996842 |
| Molecular Formula | C29H34N2O6 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (4S)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)NC2=C(C(=O)CC(C)(C)C2)[C@@H]1c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C29H34N2O6/c1-16-25(28(33)31-18-10-8-9-11-21(18)34-4)26(27-19(30-16)14-29(2,3)15-20(27)32)17-12-23(36-6)24(37-7)13-22(17)35-5/h8-13,26,30H,14-15H2,1-7H3,(H,31,33)/t26-/m1/s1 |
| InChIKey | YBLFORUQYMAJIT-AREMUKBSSA-N |
| XLogP | 4.96 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |