C27H29BrN2O4 — CID 3144725
4-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,7,7-trimethyl-N-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 3144725) has the molecular formula C27H29BrN2O4 and a molecular weight of 525.44 g/mol. Its IUPAC name is 4-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,7,7-trimethyl-N-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 4-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,7,7-trimethyl-N-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 3144725 |
| Molecular Formula | C27H29BrN2O4 |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 4-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,7,7-trimethyl-N-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | COc1cc(C2C(C(=O)Nc3ccccc3C)=C(C)NC3=C2C(=O)CC(C)(C)C3)cc(Br)c1O |
| InChI | InChI=1S/C27H29BrN2O4/c1-14-8-6-7-9-18(14)30-26(33)22-15(2)29-19-12-27(3,4)13-20(31)24(19)23(22)16-10-17(28)25(32)21(11-16)34-5/h6-11,23,29,32H,12-13H2,1-5H3,(H,30,33) |
| InChIKey | TZYRZARQKZOTGP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |