C28H32N2O4 — CID 3142906
4-(3-ethoxy-4-hydroxyphenyl)-2,7,7-trimethyl-N-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 3142906) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 4-(3-ethoxy-4-hydroxyphenyl)-2,7,7-trimethyl-N-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 4-(3-ethoxy-4-hydroxyphenyl)-2,7,7-trimethyl-N-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 3142906 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 4-(3-ethoxy-4-hydroxyphenyl)-2,7,7-trimethyl-N-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CCOc1cc(C2C(C(=O)Nc3ccccc3C)=C(C)NC3=C2C(=O)CC(C)(C)C3)ccc1O |
| InChI | InChI=1S/C28H32N2O4/c1-6-34-23-13-18(11-12-21(23)31)25-24(27(33)30-19-10-8-7-9-16(19)2)17(3)29-20-14-28(4,5)15-22(32)26(20)25/h7-13,25,29,31H,6,14-15H2,1-5H3,(H,30,33) |
| InChIKey | MAYRQAKTWFSCRH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |