C29H34N2O4 — CID 51420039
(4S)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4-(4-propoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 51420039) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is (4S)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4-(4-propoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (4S)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4-(4-propoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 51420039 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (4S)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4-(4-propoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CCCOc1ccc([C@@H]2C(C(=O)Nc3ccccc3OC)=C(C)NC3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C29H34N2O4/c1-6-15-35-20-13-11-19(12-14-20)26-25(28(33)31-21-9-7-8-10-24(21)34-5)18(2)30-22-16-29(3,4)17-23(32)27(22)26/h7-14,26,30H,6,15-17H2,1-5H3,(H,31,33)/t26-/m1/s1 |
| InChIKey | QMYLKSAZQQFVNV-AREMUKBSSA-N |
| XLogP | 5.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |