C24H19N5O4S2 — CID 2961972
2-[[5-acetyl-3-cyano-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridin-2-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide (PubChem CID 2961972) has the molecular formula C24H19N5O4S2 and a molecular weight of 505.58 g/mol. Its IUPAC name is 2-[[5-acetyl-3-cyano-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridin-2-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[[5-acetyl-3-cyano-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridin-2-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2961972 |
| Molecular Formula | C24H19N5O4S2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 2-[[5-acetyl-3-cyano-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridin-2-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide |
| SMILES | CC(=O)C1=C(C)NC(SCC(=O)Nc2nc3ccccc3s2)=C(C#N)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H19N5O4S2/c1-13-21(14(2)30)22(15-7-3-5-9-18(15)29(32)33)16(11-25)23(26-13)34-12-20(31)28-24-27-17-8-4-6-10-19(17)35-24/h3-10,22,26H,12H2,1-2H3,(H,27,28,31) |
| InChIKey | BVCBAFBVUQYYSL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|