C28H23N5O4S — CID 98368301
(4R)-5-cyano-2-methyl-6-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-N,4-diphenyl-1,4-dihydropyridine-3-carboxamide (PubChem CID 98368301) has the molecular formula C28H23N5O4S and a molecular weight of 525.59 g/mol. Its IUPAC name is (4R)-5-cyano-2-methyl-6-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-N,4-diphenyl-1,4-dihydropyridine-3-carboxamide.
| Compound Name | (4R)-5-cyano-2-methyl-6-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-N,4-diphenyl-1,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 98368301 |
| Molecular Formula | C28H23N5O4S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | (4R)-5-cyano-2-methyl-6-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-N,4-diphenyl-1,4-dihydropyridine-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@@H](c2ccccc2)C(C#N)=C(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C28H23N5O4S/c1-18-25(27(35)32-20-10-6-3-7-11-20)26(19-8-4-2-5-9-19)23(16-29)28(30-18)38-17-24(34)31-21-12-14-22(15-13-21)33(36)37/h2-15,26,30H,17H2,1H3,(H,31,34)(H,32,35)/t26-/m0/s1 |
| InChIKey | ILRCBGIFQODZMT-SANMLTNESA-N |
| XLogP | 5.30 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|