C28H22FN5O4S — CID 98385402
(4R)-5-cyano-4-(2-fluorophenyl)-2-methyl-6-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-N-phenyl-1,4-dihydropyridine-3-carboxamide (PubChem CID 98385402) has the molecular formula C28H22FN5O4S and a molecular weight of 543.58 g/mol. Its IUPAC name is (4R)-5-cyano-4-(2-fluorophenyl)-2-methyl-6-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-N-phenyl-1,4-dihydropyridine-3-carboxamide.
| Compound Name | (4R)-5-cyano-4-(2-fluorophenyl)-2-methyl-6-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-N-phenyl-1,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 98385402 |
| Molecular Formula | C28H22FN5O4S |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | (4R)-5-cyano-4-(2-fluorophenyl)-2-methyl-6-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-N-phenyl-1,4-dihydropyridine-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@H](c2ccccc2F)C(C#N)=C(SCC(=O)Nc2ccccc2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C28H22FN5O4S/c1-17-25(27(36)32-18-9-3-2-4-10-18)26(19-11-5-6-12-21(19)29)20(15-30)28(31-17)39-16-24(35)33-22-13-7-8-14-23(22)34(37)38/h2-14,26,31H,16H2,1H3,(H,32,36)(H,33,35)/t26-/m1/s1 |
| InChIKey | OLRFTTWOKZCLND-AREMUKBSSA-N |
| XLogP | 5.44 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|