C25H23ClN4O6S — CID 98368090
2-methoxyethyl (4S)-4-(2-chlorophenyl)-5-cyano-2-methyl-6-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 98368090) has the molecular formula C25H23ClN4O6S and a molecular weight of 543.00 g/mol. Its IUPAC name is 2-methoxyethyl (4S)-4-(2-chlorophenyl)-5-cyano-2-methyl-6-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-methoxyethyl (4S)-4-(2-chlorophenyl)-5-cyano-2-methyl-6-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 98368090 |
| Molecular Formula | C25H23ClN4O6S |
| Molecular Weight | 543.00 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | 2-methoxyethyl (4S)-4-(2-chlorophenyl)-5-cyano-2-methyl-6-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC(SCC(=O)Nc2ccccc2[N+](=O)[O-])=C(C#N)[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C25H23ClN4O6S/c1-15-22(25(32)36-12-11-35-2)23(16-7-3-4-8-18(16)26)17(13-27)24(28-15)37-14-21(31)29-19-9-5-6-10-20(19)30(33)34/h3-10,23,28H,11-12,14H2,1-2H3,(H,29,31)/t23-/m1/s1 |
| InChIKey | ROVUIZQNOGWPEA-HSZRJFAPSA-N |
| XLogP | 4.51 |
| TPSA | 143.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.00 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|