C29H23ClN4O5S — CID 98367964
benzyl (4R)-4-(2-chlorophenyl)-5-cyano-2-methyl-6-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 98367964) has the molecular formula C29H23ClN4O5S and a molecular weight of 575.05 g/mol. Its IUPAC name is benzyl (4R)-4-(2-chlorophenyl)-5-cyano-2-methyl-6-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | benzyl (4R)-4-(2-chlorophenyl)-5-cyano-2-methyl-6-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 98367964 |
| Molecular Formula | C29H23ClN4O5S |
| Molecular Weight | 575.05 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | benzyl (4R)-4-(2-chlorophenyl)-5-cyano-2-methyl-6-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)[C@@H](c2ccccc2Cl)C(C#N)=C(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C29H23ClN4O5S/c1-18-26(29(36)39-16-19-7-3-2-4-8-19)27(22-9-5-6-10-24(22)30)23(15-31)28(32-18)40-17-25(35)33-20-11-13-21(14-12-20)34(37)38/h2-14,27,32H,16-17H2,1H3,(H,33,35)/t27-/m0/s1 |
| InChIKey | QCOCXUZNWCVYQH-MHZLTWQESA-N |
| XLogP | 6.06 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.05 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|