C23H21N3O4S — CID 3793911
methyl 5-cyano-2-methyl-6-[(2-methylphenyl)methylsulfanyl]-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 3793911) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is methyl 5-cyano-2-methyl-6-[(2-methylphenyl)methylsulfanyl]-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 5-cyano-2-methyl-6-[(2-methylphenyl)methylsulfanyl]-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 3793911 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | methyl 5-cyano-2-methyl-6-[(2-methylphenyl)methylsulfanyl]-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(SCc2ccccc2C)=C(C#N)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21N3O4S/c1-14-8-4-5-9-16(14)13-31-22-18(12-24)21(20(15(2)25-22)23(27)30-3)17-10-6-7-11-19(17)26(28)29/h4-11,21,25H,13H2,1-3H3 |
| InChIKey | STDYGARCDAQAQV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|