C10H10N2O7S — CID 129084912
(4R,5R)-4-(2-nitrophenyl)-2-oxo-5-(sulfinamoyloxymethyl)-1,3-dioxolane (PubChem CID 129084912) has the molecular formula C10H10N2O7S and a molecular weight of 302.26 g/mol. Its IUPAC name is (4R,5R)-4-(2-nitrophenyl)-2-oxo-5-(sulfinamoyloxymethyl)-1,3-dioxolane.
| Compound Name | (4R,5R)-4-(2-nitrophenyl)-2-oxo-5-(sulfinamoyloxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 129084912 |
| Molecular Formula | C10H10N2O7S |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (4R,5R)-4-(2-nitrophenyl)-2-oxo-5-(sulfinamoyloxymethyl)-1,3-dioxolane |
| SMILES | NS(=O)OC[C@H]1OC(=O)O[C@@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O7S/c11-20(16)17-5-8-9(19-10(13)18-8)6-3-1-2-4-7(6)12(14)15/h1-4,8-9H,5,11H2/t8-,9-,20?/m1/s1 |
| InChIKey | VFHNGZNNTHZRIO-ZCDKKFEDSA-N |
| XLogP | 0.73 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|