C12H15NO6 — CID 57193130
(2S,4S,5R)-5-(hydroxymethyl)-2-[(2-nitrophenyl)methyl]oxolane-2,4-diol (PubChem CID 57193130) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is (2S,4S,5R)-5-(hydroxymethyl)-2-[(2-nitrophenyl)methyl]oxolane-2,4-diol.
| Compound Name | (2S,4S,5R)-5-(hydroxymethyl)-2-[(2-nitrophenyl)methyl]oxolane-2,4-diol |
|---|---|
| PubChem CID | 57193130 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2S,4S,5R)-5-(hydroxymethyl)-2-[(2-nitrophenyl)methyl]oxolane-2,4-diol |
| SMILES | O=[N+]([O-])c1ccccc1C[C@@]1(O)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C12H15NO6/c14-7-11-10(15)6-12(16,19-11)5-8-3-1-2-4-9(8)13(17)18/h1-4,10-11,14-16H,5-7H2/t10-,11+,12-/m0/s1 |
| InChIKey | MOOXFUYKVRISGE-TUAOUCFPSA-N |
| XLogP | -0.03 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|