C12H15NO6 — CID 15224674
(2R,3S)-2-(hydroxymethyl)-5-[(2-nitrophenyl)methoxy]oxolan-3-ol (PubChem CID 15224674) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is (2R,3S)-2-(hydroxymethyl)-5-[(2-nitrophenyl)methoxy]oxolan-3-ol.
| Compound Name | (2R,3S)-2-(hydroxymethyl)-5-[(2-nitrophenyl)methoxy]oxolan-3-ol |
|---|---|
| PubChem CID | 15224674 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2R,3S)-2-(hydroxymethyl)-5-[(2-nitrophenyl)methoxy]oxolan-3-ol |
| SMILES | O=[N+]([O-])c1ccccc1COC1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C12H15NO6/c14-6-11-10(15)5-12(19-11)18-7-8-3-1-2-4-9(8)13(16)17/h1-4,10-12,14-15H,5-7H2/t10-,11+,12?/m0/s1 |
| InChIKey | MFAPWSRHAKOBND-WIKAKEFZSA-N |
| XLogP | 0.58 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|