C17H19N3O9 — CID 135122087
1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2-nitrophenyl)methoxymethoxy]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 135122087) has the molecular formula C17H19N3O9 and a molecular weight of 409.35 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2-nitrophenyl)methoxymethoxy]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2-nitrophenyl)methoxymethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135122087 |
| Molecular Formula | C17H19N3O9 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2-nitrophenyl)methoxymethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2OCOCc2ccccc2[N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C17H19N3O9/c21-7-12-14(23)15(16(29-12)19-6-5-13(22)18-17(19)24)28-9-27-8-10-3-1-2-4-11(10)20(25)26/h1-6,12,14-16,21,23H,7-9H2,(H,18,22,24)/t12-,14-,15-,16-/m1/s1 |
| InChIKey | QPIWXBOVTCOYAN-DTZQCDIJSA-N |
| XLogP | -0.75 |
| TPSA | 166.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|