C15H15N3O7S2 — CID 24867027
1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2-nitrophenyl)disulfanyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 24867027) has the molecular formula C15H15N3O7S2 and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2-nitrophenyl)disulfanyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2-nitrophenyl)disulfanyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 24867027 |
| Molecular Formula | C15H15N3O7S2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2-nitrophenyl)disulfanyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)C(O)C2SSc2ccccc2[N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C15H15N3O7S2/c19-7-9-12(21)13(14(25-9)17-6-5-11(20)16-15(17)22)27-26-10-4-2-1-3-8(10)18(23)24/h1-6,9,12-14,19,21H,7H2,(H,16,20,22)/t9-,12?,13?,14-/m1/s1 |
| InChIKey | GMHPNJBYDORLDS-QKBYSORXSA-N |
| XLogP | 0.50 |
| TPSA | 147.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|