C16H8BrClN2O4 — CID 110580735
1-(4-bromophenyl)-3-chloro-4-(4-nitrophenyl)pyrrole-2,5-dione (PubChem CID 110580735) has the molecular formula C16H8BrClN2O4 and a molecular weight of 407.61 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-chloro-4-(4-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(4-bromophenyl)-3-chloro-4-(4-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110580735 |
| Molecular Formula | C16H8BrClN2O4 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | 1-(4-bromophenyl)-3-chloro-4-(4-nitrophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(c2ccc([N+](=O)[O-])cc2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H8BrClN2O4/c17-10-3-7-11(8-4-10)19-15(21)13(14(18)16(19)22)9-1-5-12(6-2-9)20(23)24/h1-8H |
| InChIKey | VGSNXBSXXNIRKI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|