C33H36N6O4 — CID 69404526
4-[5-cyclohexyl-8-methyl-1-(4-nitrophenyl)-2-oxo-1,3,4-benzotriazepin-3-yl]-N-phenylpiperidine-1-carboxamide (PubChem CID 69404526) has the molecular formula C33H36N6O4 and a molecular weight of 580.69 g/mol. Its IUPAC name is 4-[5-cyclohexyl-8-methyl-1-(4-nitrophenyl)-2-oxo-1,3,4-benzotriazepin-3-yl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[5-cyclohexyl-8-methyl-1-(4-nitrophenyl)-2-oxo-1,3,4-benzotriazepin-3-yl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 69404526 |
| Molecular Formula | C33H36N6O4 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 4-[5-cyclohexyl-8-methyl-1-(4-nitrophenyl)-2-oxo-1,3,4-benzotriazepin-3-yl]-N-phenylpiperidine-1-carboxamide |
| SMILES | Cc1ccc2c(c1)N(c1ccc([N+](=O)[O-])cc1)C(=O)N(C1CCN(C(=O)Nc3ccccc3)CC1)N=C2C1CCCCC1 |
| InChI | InChI=1S/C33H36N6O4/c1-23-12-17-29-30(22-23)37(26-13-15-28(16-14-26)39(42)43)33(41)38(35-31(29)24-8-4-2-5-9-24)27-18-20-36(21-19-27)32(40)34-25-10-6-3-7-11-25/h3,6-7,10-17,22,24,27H,2,4-5,8-9,18-21H2,1H3,(H,34,40) |
| InChIKey | LLNDYPOBPOWACR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|