C26H32N4O3 — CID 69425066
1-(4-aminophenyl)-5-cyclohexyl-8-methoxy-3-(oxan-4-yl)-1,3,4-benzotriazepin-2-one (PubChem CID 69425066) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-(4-aminophenyl)-5-cyclohexyl-8-methoxy-3-(oxan-4-yl)-1,3,4-benzotriazepin-2-one.
| Compound Name | 1-(4-aminophenyl)-5-cyclohexyl-8-methoxy-3-(oxan-4-yl)-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 69425066 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-(4-aminophenyl)-5-cyclohexyl-8-methoxy-3-(oxan-4-yl)-1,3,4-benzotriazepin-2-one |
| SMILES | COc1ccc2c(c1)N(c1ccc(N)cc1)C(=O)N(C1CCOCC1)N=C2C1CCCCC1 |
| InChI | InChI=1S/C26H32N4O3/c1-32-22-11-12-23-24(17-22)29(20-9-7-19(27)8-10-20)26(31)30(21-13-15-33-16-14-21)28-25(23)18-5-3-2-4-6-18/h7-12,17-18,21H,2-6,13-16,27H2,1H3 |
| InChIKey | KMDSOJSHUVJMIU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|