C30H36N4O2 — CID 69414516
4-[4-[5-cyclohexyl-8-methyl-3-(oxan-4-yl)-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]butanenitrile (PubChem CID 69414516) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 4-[4-[5-cyclohexyl-8-methyl-3-(oxan-4-yl)-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]butanenitrile.
| Compound Name | 4-[4-[5-cyclohexyl-8-methyl-3-(oxan-4-yl)-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]butanenitrile |
|---|---|
| PubChem CID | 69414516 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 4-[4-[5-cyclohexyl-8-methyl-3-(oxan-4-yl)-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]butanenitrile |
| SMILES | Cc1ccc2c(c1)N(c1ccc(CCCC#N)cc1)C(=O)N(C1CCOCC1)N=C2C1CCCCC1 |
| InChI | InChI=1S/C30H36N4O2/c1-22-10-15-27-28(21-22)33(25-13-11-23(12-14-25)7-5-6-18-31)30(35)34(26-16-19-36-20-17-26)32-29(27)24-8-3-2-4-9-24/h10-15,21,24,26H,2-9,16-17,19-20H2,1H3 |
| InChIKey | PRLUIAFSFNGCBU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 68.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|