C32H45N5O2 — CID 16750145
5-cyclohexyl-8-methyl-3-(oxan-4-yl)-1-[4-[3-(propan-2-ylamino)propylamino]phenyl]-1,3,4-benzotriazepin-2-one (PubChem CID 16750145) has the molecular formula C32H45N5O2 and a molecular weight of 531.75 g/mol. Its IUPAC name is 5-cyclohexyl-8-methyl-3-(oxan-4-yl)-1-[4-[3-(propan-2-ylamino)propylamino]phenyl]-1,3,4-benzotriazepin-2-one.
| Compound Name | 5-cyclohexyl-8-methyl-3-(oxan-4-yl)-1-[4-[3-(propan-2-ylamino)propylamino]phenyl]-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 16750145 |
| Molecular Formula | C32H45N5O2 |
| Molecular Weight | 531.75 g/mol |
| Exact Mass | 531.36 |
| IUPAC Name | 5-cyclohexyl-8-methyl-3-(oxan-4-yl)-1-[4-[3-(propan-2-ylamino)propylamino]phenyl]-1,3,4-benzotriazepin-2-one |
| SMILES | Cc1ccc2c(c1)N(c1ccc(NCCCNC(C)C)cc1)C(=O)N(C1CCOCC1)N=C2C1CCCCC1 |
| InChI | InChI=1S/C32H45N5O2/c1-23(2)33-18-7-19-34-26-11-13-27(14-12-26)36-30-22-24(3)10-15-29(30)31(25-8-5-4-6-9-25)35-37(32(36)38)28-16-20-39-21-17-28/h10-15,22-23,25,28,33-34H,4-9,16-21H2,1-3H3 |
| InChIKey | LTBYYPKNUANVRD-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.75 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|