C51H53N5O3 — CID 90766629
5-cyclohexyl-8-methyl-3-(oxan-4-yl)-1-[4-[3-(5-trityl-1H-imidazol-2-yl)propoxy]phenyl]-1,3,4-benzotriazepin-2-one (PubChem CID 90766629) has the molecular formula C51H53N5O3 and a molecular weight of 784.02 g/mol. Its IUPAC name is 5-cyclohexyl-8-methyl-3-(oxan-4-yl)-1-[4-[3-(5-trityl-1H-imidazol-2-yl)propoxy]phenyl]-1,3,4-benzotriazepin-2-one.
| Compound Name | 5-cyclohexyl-8-methyl-3-(oxan-4-yl)-1-[4-[3-(5-trityl-1H-imidazol-2-yl)propoxy]phenyl]-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 90766629 |
| Molecular Formula | C51H53N5O3 |
| Molecular Weight | 784.02 g/mol |
| Exact Mass | 783.41 |
| IUPAC Name | 5-cyclohexyl-8-methyl-3-(oxan-4-yl)-1-[4-[3-(5-trityl-1H-imidazol-2-yl)propoxy]phenyl]-1,3,4-benzotriazepin-2-one |
| SMILES | Cc1ccc2c(c1)N(c1ccc(OCCCc3ncc(C(c4ccccc4)(c4ccccc4)c4ccccc4)[nH]3)cc1)C(=O)N(C1CCOCC1)N=C2C1CCCCC1 |
| InChI | InChI=1S/C51H53N5O3/c1-37-24-29-45-46(35-37)55(50(57)56(43-30-33-58-34-31-43)54-49(45)38-15-6-2-7-16-38)42-25-27-44(28-26-42)59-32-14-23-48-52-36-47(53-48)51(39-17-8-3-9-18-39,40-19-10-4-11-20-40)41-21-12-5-13-22-41/h3-5,8-13,17-22,24-29,35-36,38,43H,2,6-7,14-16,23,30-34H2,1H3,(H,52,53) |
| InChIKey | JXYKEKCLEQURDJ-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.02 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|