C50H51N5O3 — CID 69405223
5-cyclohexyl-1-[4-[1-(1H-imidazol-2-ylmethoxy)-2,2,2-triphenylethyl]phenyl]-8-methyl-3-(oxan-4-yl)-1,3,4-benzotriazepin-2-one (PubChem CID 69405223) has the molecular formula C50H51N5O3 and a molecular weight of 769.99 g/mol. Its IUPAC name is 5-cyclohexyl-1-[4-[1-(1H-imidazol-2-ylmethoxy)-2,2,2-triphenylethyl]phenyl]-8-methyl-3-(oxan-4-yl)-1,3,4-benzotriazepin-2-one.
| Compound Name | 5-cyclohexyl-1-[4-[1-(1H-imidazol-2-ylmethoxy)-2,2,2-triphenylethyl]phenyl]-8-methyl-3-(oxan-4-yl)-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 69405223 |
| Molecular Formula | C50H51N5O3 |
| Molecular Weight | 769.99 g/mol |
| Exact Mass | 769.40 |
| IUPAC Name | 5-cyclohexyl-1-[4-[1-(1H-imidazol-2-ylmethoxy)-2,2,2-triphenylethyl]phenyl]-8-methyl-3-(oxan-4-yl)-1,3,4-benzotriazepin-2-one |
| SMILES | Cc1ccc2c(c1)N(c1ccc(C(OCc3ncc[nH]3)C(c3ccccc3)(c3ccccc3)c3ccccc3)cc1)C(=O)N(C1CCOCC1)N=C2C1CCCCC1 |
| InChI | InChI=1S/C50H51N5O3/c1-36-22-27-44-45(34-36)54(49(56)55(43-28-32-57-33-29-43)53-47(44)37-14-6-2-7-15-37)42-25-23-38(24-26-42)48(58-35-46-51-30-31-52-46)50(39-16-8-3-9-17-39,40-18-10-4-11-19-40)41-20-12-5-13-21-41/h3-5,8-13,16-27,30-31,34,37,43,48H,2,6-7,14-15,28-29,32-33,35H2,1H3,(H,51,52) |
| InChIKey | SLMNAQOLABRLGM-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.99 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|