C37H53N5O4 — CID 69406027
2-amino-N-[4-[5-cyclohexyl-7,8-dimethoxy-2-oxo-3-(3,3,5,5-tetramethylcyclohexyl)-1,3,4-benzotriazepin-1-yl]phenyl]-3-methylbutanamide (PubChem CID 69406027) has the molecular formula C37H53N5O4 and a molecular weight of 631.86 g/mol. Its IUPAC name is 2-amino-N-[4-[5-cyclohexyl-7,8-dimethoxy-2-oxo-3-(3,3,5,5-tetramethylcyclohexyl)-1,3,4-benzotriazepin-1-yl]phenyl]-3-methylbutanamide.
| Compound Name | 2-amino-N-[4-[5-cyclohexyl-7,8-dimethoxy-2-oxo-3-(3,3,5,5-tetramethylcyclohexyl)-1,3,4-benzotriazepin-1-yl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 69406027 |
| Molecular Formula | C37H53N5O4 |
| Molecular Weight | 631.86 g/mol |
| Exact Mass | 631.41 |
| IUPAC Name | 2-amino-N-[4-[5-cyclohexyl-7,8-dimethoxy-2-oxo-3-(3,3,5,5-tetramethylcyclohexyl)-1,3,4-benzotriazepin-1-yl]phenyl]-3-methylbutanamide |
| SMILES | COc1cc2c(cc1OC)N(c1ccc(NC(=O)C(N)C(C)C)cc1)C(=O)N(C1CC(C)(C)CC(C)(C)C1)N=C2C1CCCCC1 |
| InChI | InChI=1S/C37H53N5O4/c1-23(2)32(38)34(43)39-25-14-16-26(17-15-25)41-29-19-31(46-8)30(45-7)18-28(29)33(24-12-10-9-11-13-24)40-42(35(41)44)27-20-36(3,4)22-37(5,6)21-27/h14-19,23-24,27,32H,9-13,20-22,38H2,1-8H3,(H,39,43) |
| InChIKey | SWVBBGPZWSKAQG-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.86 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |