C36H51N5O2 — CID 69406909
2-amino-N-[4-[5-cyclohexyl-9-methyl-2-oxo-3-(3,3,5,5-tetramethylcyclohexyl)-1,3,4-benzotriazepin-1-yl]phenyl]-3-methylbutanamide (PubChem CID 69406909) has the molecular formula C36H51N5O2 and a molecular weight of 585.84 g/mol. Its IUPAC name is 2-amino-N-[4-[5-cyclohexyl-9-methyl-2-oxo-3-(3,3,5,5-tetramethylcyclohexyl)-1,3,4-benzotriazepin-1-yl]phenyl]-3-methylbutanamide.
| Compound Name | 2-amino-N-[4-[5-cyclohexyl-9-methyl-2-oxo-3-(3,3,5,5-tetramethylcyclohexyl)-1,3,4-benzotriazepin-1-yl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 69406909 |
| Molecular Formula | C36H51N5O2 |
| Molecular Weight | 585.84 g/mol |
| Exact Mass | 585.40 |
| IUPAC Name | 2-amino-N-[4-[5-cyclohexyl-9-methyl-2-oxo-3-(3,3,5,5-tetramethylcyclohexyl)-1,3,4-benzotriazepin-1-yl]phenyl]-3-methylbutanamide |
| SMILES | Cc1cccc2c1N(c1ccc(NC(=O)C(N)C(C)C)cc1)C(=O)N(C1CC(C)(C)CC(C)(C)C1)N=C2C1CCCCC1 |
| InChI | InChI=1S/C36H51N5O2/c1-23(2)30(37)33(42)38-26-16-18-27(19-17-26)40-32-24(3)12-11-15-29(32)31(25-13-9-8-10-14-25)39-41(34(40)43)28-20-35(4,5)22-36(6,7)21-28/h11-12,15-19,23,25,28,30H,8-10,13-14,20-22,37H2,1-7H3,(H,38,42) |
| InChIKey | HRTDGMFEUVNNAV-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.84 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |