About 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene]
10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene] (PubChem CID 143268859) has the molecular formula C31H20N2O2
and a molecular weight of 452.51 g/mol. Its IUPAC name is 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene].
Molecular Properties
| Compound Name | 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene] |
| PubChem CID | 143268859 |
| Molecular Formula | C31H20N2O2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene] |
| SMILES | O=[N+]([O-])c1ccc(N2c3ccccc3C3(c4ccccc4-c4ccccc43)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H20N2O2/c34-33(35)22-19-17-21(18-20-22)32-29-15-7-5-13-27(29)31(28-14-6-8-16-30(28)32)25-11-3-1-9-23(25)24-10-2-4-12-26(24)31/h1-20H |
| InChIKey | PDYRGRUZHCXZAA-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene]?
The IUPAC name of 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene] (CID 143268859) is 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene].
What is the SMILES notation for 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene]?
The canonical SMILES for 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene] is O=[N+]([O-])c1ccc(N2c3ccccc3C3(c4ccccc4-c4ccccc43)c3ccccc32)cc1.
What is the InChIKey of 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene]?
The InChIKey is PDYRGRUZHCXZAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H20N2O2/c34-33(35)22-19-17-21(18-20-22)32-29-15-7-5-13-27(29)31(28-14-6-8-16-30(28)32)25-11-3-1-9-23(25)24-10-2-4-12-26(24)31/h1-20H.
What are the key properties of 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene]?
10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene] has a molecular weight of 452.51 g/mol, XLogP of 7.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4-nitrophenyl)spiro[acridine-9,9'-fluorene] is sourced from PubChem (CID 143268859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).