C36H31N3O2 — CID 59399557
10-[3-(9,9-dimethylacridin-10-yl)-5-nitrophenyl]-9,9-dimethylacridine (PubChem CID 59399557) has the molecular formula C36H31N3O2 and a molecular weight of 537.66 g/mol. Its IUPAC name is 10-[3-(9,9-dimethylacridin-10-yl)-5-nitrophenyl]-9,9-dimethylacridine.
| Compound Name | 10-[3-(9,9-dimethylacridin-10-yl)-5-nitrophenyl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 59399557 |
| Molecular Formula | C36H31N3O2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 10-[3-(9,9-dimethylacridin-10-yl)-5-nitrophenyl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccccc2N(c2cc(N3c4ccccc4C(C)(C)c4ccccc43)cc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C36H31N3O2/c1-35(2)27-13-5-9-17-31(27)37(32-18-10-6-14-28(32)35)24-21-25(23-26(22-24)39(40)41)38-33-19-11-7-15-29(33)36(3,4)30-16-8-12-20-34(30)38/h5-23H,1-4H3 |
| InChIKey | NBGOHIKLHBRRRZ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|