C16H11N3O5 — CID 15351216
5-(4-methoxyphenyl)-2-(4-nitrophenyl)pyrazole-3,4-dione (PubChem CID 15351216) has the molecular formula C16H11N3O5 and a molecular weight of 325.28 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-(4-nitrophenyl)pyrazole-3,4-dione.
| Compound Name | 5-(4-methoxyphenyl)-2-(4-nitrophenyl)pyrazole-3,4-dione |
|---|---|
| PubChem CID | 15351216 |
| Molecular Formula | C16H11N3O5 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-(4-nitrophenyl)pyrazole-3,4-dione |
| SMILES | COc1ccc(C2=NN(c3ccc([N+](=O)[O-])cc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C16H11N3O5/c1-24-13-8-2-10(3-9-13)14-15(20)16(21)18(17-14)11-4-6-12(7-5-11)19(22)23/h2-9H,1H3 |
| InChIKey | WJRPVFRFPUYVBG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|