C17H12BrN3O5 — CID 53255179
3-bromo-4-(4-methoxyanilino)-1-(4-nitrophenyl)pyrrole-2,5-dione (PubChem CID 53255179) has the molecular formula C17H12BrN3O5 and a molecular weight of 418.20 g/mol. Its IUPAC name is 3-bromo-4-(4-methoxyanilino)-1-(4-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 3-bromo-4-(4-methoxyanilino)-1-(4-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 53255179 |
| Molecular Formula | C17H12BrN3O5 |
| Molecular Weight | 418.20 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 3-bromo-4-(4-methoxyanilino)-1-(4-nitrophenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(NC2=C(Br)C(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C17H12BrN3O5/c1-26-13-8-2-10(3-9-13)19-15-14(18)16(22)20(17(15)23)11-4-6-12(7-5-11)21(24)25/h2-9,19H,1H3 |
| InChIKey | AQHQVGGKTCMJAD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|