C23H16N4O4 — CID 98459329
(3aR,6aR)-3-(4-nitrophenyl)-1,5-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 98459329) has the molecular formula C23H16N4O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is (3aR,6aR)-3-(4-nitrophenyl)-1,5-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aR,6aR)-3-(4-nitrophenyl)-1,5-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 98459329 |
| Molecular Formula | C23H16N4O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (3aR,6aR)-3-(4-nitrophenyl)-1,5-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | O=C1[C@H]2C(c3ccc([N+](=O)[O-])cc3)=NN(c3ccccc3)[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H16N4O4/c28-22-19-20(15-11-13-18(14-12-15)27(30)31)24-26(17-9-5-2-6-10-17)21(19)23(29)25(22)16-7-3-1-4-8-16/h1-14,19,21H/t19-,21+/m0/s1 |
| InChIKey | XBZVSHPSYCLFJU-PZJWPPBQSA-N |
| XLogP | 3.38 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|