C27H18N4O4 — CID 98454414
(3aS,6aR)-5-naphthalen-2-yl-3-(4-nitrophenyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 98454414) has the molecular formula C27H18N4O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is (3aS,6aR)-5-naphthalen-2-yl-3-(4-nitrophenyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aS,6aR)-5-naphthalen-2-yl-3-(4-nitrophenyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 98454414 |
| Molecular Formula | C27H18N4O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (3aS,6aR)-5-naphthalen-2-yl-3-(4-nitrophenyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | O=C1[C@@H]2C(c3ccc([N+](=O)[O-])cc3)=NN(c3ccccc3)[C@H]2C(=O)N1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H18N4O4/c32-26-23-24(18-11-13-21(14-12-18)31(34)35)28-30(20-8-2-1-3-9-20)25(23)27(33)29(26)22-15-10-17-6-4-5-7-19(17)16-22/h1-16,23,25H/t23-,25-/m1/s1 |
| InChIKey | LORZOHOGGFVLCX-ILBGXUMGSA-N |
| XLogP | 4.53 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|