C23H14Cl2N4O4 — CID 3769546
5-(3,5-dichlorophenyl)-3-(4-nitrophenyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 3769546) has the molecular formula C23H14Cl2N4O4 and a molecular weight of 481.30 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-3-(4-nitrophenyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | 5-(3,5-dichlorophenyl)-3-(4-nitrophenyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 3769546 |
| Molecular Formula | C23H14Cl2N4O4 |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-3-(4-nitrophenyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | O=C1C2C(c3ccc([N+](=O)[O-])cc3)=NN(c3ccccc3)C2C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H14Cl2N4O4/c24-14-10-15(25)12-18(11-14)27-22(30)19-20(13-6-8-17(9-7-13)29(32)33)26-28(21(19)23(27)31)16-4-2-1-3-5-16/h1-12,19,21H |
| InChIKey | SUFMMOGATWGVPE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|