C24H16Cl2N4O5 — CID 98078181
(3aR,6aS)-3-(2,4-dichlorophenyl)-5-(4-methoxyphenyl)-1-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 98078181) has the molecular formula C24H16Cl2N4O5 and a molecular weight of 511.32 g/mol. Its IUPAC name is (3aR,6aS)-3-(2,4-dichlorophenyl)-5-(4-methoxyphenyl)-1-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aR,6aS)-3-(2,4-dichlorophenyl)-5-(4-methoxyphenyl)-1-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 98078181 |
| Molecular Formula | C24H16Cl2N4O5 |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | (3aR,6aS)-3-(2,4-dichlorophenyl)-5-(4-methoxyphenyl)-1-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | COc1ccc(N2C(=O)[C@H]3C(c4ccc(Cl)cc4Cl)=NN(c4ccc([N+](=O)[O-])cc4)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C24H16Cl2N4O5/c1-35-17-9-7-14(8-10-17)28-23(31)20-21(18-11-2-13(25)12-19(18)26)27-29(22(20)24(28)32)15-3-5-16(6-4-15)30(33)34/h2-12,20,22H,1H3/t20-,22-/m0/s1 |
| InChIKey | IMPUXKZIEFXEFZ-UNMCSNQZSA-N |
| XLogP | 4.69 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|