C21H13Cl2N3O3 — CID 98213573
(3aS,6aS)-5-(3,4-dichlorophenyl)-3-(furan-2-yl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 98213573) has the molecular formula C21H13Cl2N3O3 and a molecular weight of 426.26 g/mol. Its IUPAC name is (3aS,6aS)-5-(3,4-dichlorophenyl)-3-(furan-2-yl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aS,6aS)-5-(3,4-dichlorophenyl)-3-(furan-2-yl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 98213573 |
| Molecular Formula | C21H13Cl2N3O3 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | (3aS,6aS)-5-(3,4-dichlorophenyl)-3-(furan-2-yl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | O=C1[C@@H]2C(c3ccco3)=NN(c3ccccc3)[C@@H]2C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H13Cl2N3O3/c22-14-9-8-13(11-15(14)23)25-20(27)17-18(16-7-4-10-29-16)24-26(19(17)21(25)28)12-5-2-1-3-6-12/h1-11,17,19H/t17-,19+/m1/s1 |
| InChIKey | QSSJXNLYJCALBQ-MJGOQNOKSA-N |
| XLogP | 4.37 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|