C26H16ClN3O4 — CID 10895985
(3aR,6aR)-3-(5-chloro-2-oxochromen-4-yl)-1,5-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 10895985) has the molecular formula C26H16ClN3O4 and a molecular weight of 469.88 g/mol. Its IUPAC name is (3aR,6aR)-3-(5-chloro-2-oxochromen-4-yl)-1,5-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aR,6aR)-3-(5-chloro-2-oxochromen-4-yl)-1,5-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 10895985 |
| Molecular Formula | C26H16ClN3O4 |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | (3aR,6aR)-3-(5-chloro-2-oxochromen-4-yl)-1,5-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | O=C1[C@H]2C(c3cc(=O)oc4cccc(Cl)c34)=NN(c3ccccc3)[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C26H16ClN3O4/c27-18-12-7-13-19-21(18)17(14-20(31)34-19)23-22-24(30(28-23)16-10-5-2-6-11-16)26(33)29(25(22)32)15-8-3-1-4-9-15/h1-14,22,24H/t22-,24+/m0/s1 |
| InChIKey | KSIGMLQZZUPIIS-LADGPHEKSA-N |
| XLogP | 4.23 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|