C17H14N2O3 — CID 7111920
(2R)-3-(2,4-dimethylphenyl)imino-2-nitroinden-1-one (PubChem CID 7111920) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2R)-3-(2,4-dimethylphenyl)imino-2-nitroinden-1-one.
| Compound Name | (2R)-3-(2,4-dimethylphenyl)imino-2-nitroinden-1-one |
|---|---|
| PubChem CID | 7111920 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2R)-3-(2,4-dimethylphenyl)imino-2-nitroinden-1-one |
| SMILES | Cc1ccc(/N=C2\c3ccccc3C(=O)[C@@H]2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C17H14N2O3/c1-10-7-8-14(11(2)9-10)18-15-12-5-3-4-6-13(12)17(20)16(15)19(21)22/h3-9,16H,1-2H3/b18-15+/t16-/m1/s1 |
| InChIKey | RQQNXOXUASYLGS-YWJBVVMDSA-N |
| XLogP | 3.27 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|