C24H20O2 — CID 1377907
2-[(S)-(2,4-dimethylphenyl)-phenylmethyl]indene-1,3-dione (PubChem CID 1377907) has the molecular formula C24H20O2 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[(S)-(2,4-dimethylphenyl)-phenylmethyl]indene-1,3-dione.
| Compound Name | 2-[(S)-(2,4-dimethylphenyl)-phenylmethyl]indene-1,3-dione |
|---|---|
| PubChem CID | 1377907 |
| Molecular Formula | C24H20O2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-[(S)-(2,4-dimethylphenyl)-phenylmethyl]indene-1,3-dione |
| SMILES | Cc1ccc([C@H](c2ccccc2)C2C(=O)c3ccccc3C2=O)c(C)c1 |
| InChI | InChI=1S/C24H20O2/c1-15-12-13-18(16(2)14-15)21(17-8-4-3-5-9-17)22-23(25)19-10-6-7-11-20(19)24(22)26/h3-14,21-22H,1-2H3/t21-/m0/s1 |
| InChIKey | MAOVHTGGKZIQJH-NRFANRHFSA-N |
| XLogP | 5.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|