C23H24 — CID 54025745
1-[(3,4-dimethylphenyl)-phenylmethyl]-2,4-dimethylbenzene (PubChem CID 54025745) has the molecular formula C23H24 and a molecular weight of 300.44 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenyl)-phenylmethyl]-2,4-dimethylbenzene.
| Compound Name | 1-[(3,4-dimethylphenyl)-phenylmethyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 54025745 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-[(3,4-dimethylphenyl)-phenylmethyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C(c2ccccc2)c2ccc(C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C23H24/c1-16-10-13-22(19(4)14-16)23(20-8-6-5-7-9-20)21-12-11-17(2)18(3)15-21/h5-15,23H,1-4H3 |
| InChIKey | AOQHQXDVYOTZJT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|