C17H20O2 — CID 116756761
1-(2,4-dimethylphenyl)-2-methoxy-2-phenylethanol (PubChem CID 116756761) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-methoxy-2-phenylethanol.
| Compound Name | 1-(2,4-dimethylphenyl)-2-methoxy-2-phenylethanol |
|---|---|
| PubChem CID | 116756761 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-methoxy-2-phenylethanol |
| SMILES | COC(c1ccccc1)C(O)c1ccc(C)cc1C |
| InChI | InChI=1S/C17H20O2/c1-12-9-10-15(13(2)11-12)16(18)17(19-3)14-7-5-4-6-8-14/h4-11,16-18H,1-3H3 |
| InChIKey | LDVHTDOOKUPDHA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |