C19H24O2 — CID 116757043
2-ethoxy-2-phenyl-1-(2,4,5-trimethylphenyl)ethanol (PubChem CID 116757043) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-ethoxy-2-phenyl-1-(2,4,5-trimethylphenyl)ethanol.
| Compound Name | 2-ethoxy-2-phenyl-1-(2,4,5-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 116757043 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-ethoxy-2-phenyl-1-(2,4,5-trimethylphenyl)ethanol |
| SMILES | CCOC(c1ccccc1)C(O)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C19H24O2/c1-5-21-19(16-9-7-6-8-10-16)18(20)17-12-14(3)13(2)11-15(17)4/h6-12,18-20H,5H2,1-4H3 |
| InChIKey | YHHNMLQUSUQFFL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |