C24H30O8 — CID 54296354
(3R,6S)-1,8-diethoxy-2,3,6,7-tetrahydroxy-1,8-diphenyloctane-4,5-dione (PubChem CID 54296354) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is (3R,6S)-1,8-diethoxy-2,3,6,7-tetrahydroxy-1,8-diphenyloctane-4,5-dione.
| Compound Name | (3R,6S)-1,8-diethoxy-2,3,6,7-tetrahydroxy-1,8-diphenyloctane-4,5-dione |
|---|---|
| PubChem CID | 54296354 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (3R,6S)-1,8-diethoxy-2,3,6,7-tetrahydroxy-1,8-diphenyloctane-4,5-dione |
| SMILES | CCOC(c1ccccc1)C(O)[C@H](O)C(=O)C(=O)[C@H](O)C(O)C(OCC)c1ccccc1 |
| InChI | InChI=1S/C24H30O8/c1-3-31-23(15-11-7-5-8-12-15)21(29)19(27)17(25)18(26)20(28)22(30)24(32-4-2)16-13-9-6-10-14-16/h5-14,19-24,27-30H,3-4H2,1-2H3/t19-,20+,21?,22?,23?,24? |
| InChIKey | SBAYOAKPXPEJQX-DULNRSHKSA-N |
| XLogP | 1.12 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|