C21H22N2 — CID 146638185
4-[(4-aminophenyl)-(3,4-dimethylphenyl)methyl]aniline (PubChem CID 146638185) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-[(4-aminophenyl)-(3,4-dimethylphenyl)methyl]aniline.
| Compound Name | 4-[(4-aminophenyl)-(3,4-dimethylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 146638185 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-[(4-aminophenyl)-(3,4-dimethylphenyl)methyl]aniline |
| SMILES | Cc1ccc(C(c2ccc(N)cc2)c2ccc(N)cc2)cc1C |
| InChI | InChI=1S/C21H22N2/c1-14-3-4-18(13-15(14)2)21(16-5-9-19(22)10-6-16)17-7-11-20(23)12-8-17/h3-13,21H,22-23H2,1-2H3 |
| InChIKey | AMBSUVIDEBIJJS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|