C22H21NO — CID 174996851
2-[(2,4-dimethylphenyl)-phenylmethyl]benzamide (PubChem CID 174996851) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)-phenylmethyl]benzamide.
| Compound Name | 2-[(2,4-dimethylphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 174996851 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)-phenylmethyl]benzamide |
| SMILES | Cc1ccc(C(c2ccccc2)c2ccccc2C(N)=O)c(C)c1 |
| InChI | InChI=1S/C22H21NO/c1-15-12-13-18(16(2)14-15)21(17-8-4-3-5-9-17)19-10-6-7-11-20(19)22(23)24/h3-14,21H,1-2H3,(H2,23,24) |
| InChIKey | FMMISXYRRFYNAO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|