C19H18N4O3S — CID 135455214
(5Z)-2-(2,4-dimethylphenyl)imino-5-[[4-(methylamino)-3-nitrophenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135455214) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is (5Z)-2-(2,4-dimethylphenyl)imino-5-[[4-(methylamino)-3-nitrophenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,4-dimethylphenyl)imino-5-[[4-(methylamino)-3-nitrophenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135455214 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (5Z)-2-(2,4-dimethylphenyl)imino-5-[[4-(methylamino)-3-nitrophenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CNc1ccc(/C=C2\S/C(=N/c3ccc(C)cc3C)NC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N4O3S/c1-11-4-6-14(12(2)8-11)21-19-22-18(24)17(27-19)10-13-5-7-15(20-3)16(9-13)23(25)26/h4-10,20H,1-3H3,(H,21,22,24)/b17-10- |
| InChIKey | XASGQJHXKITQPQ-YVLHZVERSA-N |
| XLogP | 4.14 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|