C24H18ClN3O3S2 — CID 135510222
5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135510222) has the molecular formula C24H18ClN3O3S2 and a molecular weight of 496.01 g/mol. Its IUPAC name is 5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135510222 |
| Molecular Formula | C24H18ClN3O3S2 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/NC(=O)C(=Cc3ccc(Sc4ccc(Cl)cc4)c([N+](=O)[O-])c3)S2)c(C)c1 |
| InChI | InChI=1S/C24H18ClN3O3S2/c1-14-3-9-19(15(2)11-14)26-24-27-23(29)22(33-24)13-16-4-10-21(20(12-16)28(30)31)32-18-7-5-17(25)6-8-18/h3-13H,1-2H3,(H,26,27,29) |
| InChIKey | CELGVELHWIDWEY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|