C24H17NO5 — CID 98416454
(3'R,4'S,5'R)-4'-nitro-3',5'-diphenylspiro[indene-2,2'-oxolane]-1,3-dione (PubChem CID 98416454) has the molecular formula C24H17NO5 and a molecular weight of 399.40 g/mol. Its IUPAC name is (3'R,4'S,5'R)-4'-nitro-3',5'-diphenylspiro[indene-2,2'-oxolane]-1,3-dione.
| Compound Name | (3'R,4'S,5'R)-4'-nitro-3',5'-diphenylspiro[indene-2,2'-oxolane]-1,3-dione |
|---|---|
| PubChem CID | 98416454 |
| Molecular Formula | C24H17NO5 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (3'R,4'S,5'R)-4'-nitro-3',5'-diphenylspiro[indene-2,2'-oxolane]-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C12O[C@H](c1ccccc1)[C@@H]([N+](=O)[O-])[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H17NO5/c26-22-17-13-7-8-14-18(17)23(27)24(22)19(15-9-3-1-4-10-15)20(25(28)29)21(30-24)16-11-5-2-6-12-16/h1-14,19-21H/t19-,20+,21-/m1/s1 |
| InChIKey | KTUUHORZVGWSQT-QHAWAJNXSA-N |
| XLogP | 4.01 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|