C16H10O3 — CID 3142214
3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione (PubChem CID 3142214) has the molecular formula C16H10O3 and a molecular weight of 250.25 g/mol. Its IUPAC name is 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione.
| Compound Name | 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione |
|---|---|
| PubChem CID | 3142214 |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C12OC2c1ccccc1 |
| InChI | InChI=1S/C16H10O3/c17-13-11-8-4-5-9-12(11)14(18)16(13)15(19-16)10-6-2-1-3-7-10/h1-9,15H |
| InChIKey | DXBPSHSLDUYBJI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|