About 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione
3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione (PubChem CID 3142214) has the molecular formula C16H10O3
and a molecular weight of 250.25 g/mol. Its IUPAC name is 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione.
Molecular Properties
| Compound Name | 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione |
| PubChem CID | 3142214 |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C12OC2c1ccccc1 |
| InChI | InChI=1S/C16H10O3/c17-13-11-8-4-5-9-12(11)14(18)16(13)15(19-16)10-6-2-1-3-7-10/h1-9,15H |
| InChIKey | DXBPSHSLDUYBJI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione?
The IUPAC name of 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione (CID 3142214) is 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione.
What is the SMILES notation for 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione?
The canonical SMILES for 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione is O=C1c2ccccc2C(=O)C12OC2c1ccccc1.
What is the InChIKey of 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione?
The InChIKey is DXBPSHSLDUYBJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O3/c17-13-11-8-4-5-9-12(11)14(18)16(13)15(19-16)10-6-2-1-3-7-10/h1-9,15H.
What are the key properties of 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione?
3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione has a molecular weight of 250.25 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-phenylspiro[indene-2,2'-oxirane]-1,3-dione is sourced from PubChem (CID 3142214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).