C16H12O2 — CID 736601
(2R,3'R)-3'-phenylspiro[3H-indene-2,2'-oxirane]-1-one (PubChem CID 736601) has the molecular formula C16H12O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2R,3'R)-3'-phenylspiro[3H-indene-2,2'-oxirane]-1-one.
| Compound Name | (2R,3'R)-3'-phenylspiro[3H-indene-2,2'-oxirane]-1-one |
|---|---|
| PubChem CID | 736601 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (2R,3'R)-3'-phenylspiro[3H-indene-2,2'-oxirane]-1-one |
| SMILES | O=C1c2ccccc2C[C@]12O[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C16H12O2/c17-14-13-9-5-4-8-12(13)10-16(14)15(18-16)11-6-2-1-3-7-11/h1-9,15H,10H2/t15-,16+/m1/s1 |
| InChIKey | BPRSFVHQRNUUPG-CVEARBPZSA-N |
| XLogP | 2.94 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|