C17H13FO2 — CID 6933122
(2S,3'S)-3'-(4-fluorophenyl)spiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one (PubChem CID 6933122) has the molecular formula C17H13FO2 and a molecular weight of 268.29 g/mol. Its IUPAC name is (2S,3'S)-3'-(4-fluorophenyl)spiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one.
| Compound Name | (2S,3'S)-3'-(4-fluorophenyl)spiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
|---|---|
| PubChem CID | 6933122 |
| Molecular Formula | C17H13FO2 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2S,3'S)-3'-(4-fluorophenyl)spiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
| SMILES | O=C1c2ccccc2CC[C@@]12O[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FO2/c18-13-7-5-12(6-8-13)16-17(20-16)10-9-11-3-1-2-4-14(11)15(17)19/h1-8,16H,9-10H2/t16-,17+/m0/s1 |
| InChIKey | AOJSZYRQBJDUAE-DLBZAZTESA-N |
| XLogP | 3.46 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|