C22H15FO3 — CID 6554165
(2R,3S,3'R)-3'-(4-fluorophenyl)-2-phenylspiro[2H-chromene-3,2'-oxirane]-4-one (PubChem CID 6554165) has the molecular formula C22H15FO3 and a molecular weight of 346.36 g/mol. Its IUPAC name is (2R,3S,3'R)-3'-(4-fluorophenyl)-2-phenylspiro[2H-chromene-3,2'-oxirane]-4-one.
| Compound Name | (2R,3S,3'R)-3'-(4-fluorophenyl)-2-phenylspiro[2H-chromene-3,2'-oxirane]-4-one |
|---|---|
| PubChem CID | 6554165 |
| Molecular Formula | C22H15FO3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (2R,3S,3'R)-3'-(4-fluorophenyl)-2-phenylspiro[2H-chromene-3,2'-oxirane]-4-one |
| SMILES | O=C1c2ccccc2O[C@H](c2ccccc2)[C@]12O[C@@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C22H15FO3/c23-16-12-10-15(11-13-16)21-22(26-21)19(24)17-8-4-5-9-18(17)25-20(22)14-6-2-1-3-7-14/h1-13,20-21H/t20-,21-,22-/m1/s1 |
| InChIKey | DLHWSFRTHSDMEO-YPAWHYETSA-N |
| XLogP | 4.65 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|